* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34348175 |
English Synonyms: | UKRORGSYN-BB BBV-34348175 |
MDL Number.: | MFCD16799243 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(CNc1ccccc1)n2cccn2 |
InChi: | InChI=1S/C12H15N3/c1-11(15-9-5-8-14-15)10-13-12-6-3-2-4-7-12/h2-9,11,13H,10H2,1H3 |
InChiKey: | InChIKey=DIGLDGIGFNYPMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.