* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34348395 |
| English Synonyms: | UKRORGSYN-BB BBV-34348395 |
| MDL Number.: | MFCD16799462 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C#CCNCCn1ccc2c1cccc2 |
| InChi: | InChI=1S/C13H14N2/c1-2-8-14-9-11-15-10-7-12-5-3-4-6-13(12)15/h1,3-7,10,14H,8-9,11H2 |
| InChiKey: | InChIKey=LBMIUYCFDPCIMQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.