* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349026 |
English Synonyms: | UKRORGSYN-BB BBV-34349026 |
MDL Number.: | MFCD16800084 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC(C)NCC(C)n1cc(cn1)Br |
InChi: | InChI=1S/C10H18BrN3/c1-4-8(2)12-5-9(3)14-7-10(11)6-13-14/h6-9,12H,4-5H2,1-3H3 |
InChiKey: | InChIKey=GGZFZURMXZWUCP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.