* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34349046 |
English Synonyms: | UKRORGSYN-BB BBV-34349046 |
MDL Number.: | MFCD16800104 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccccc1NCCn2cc(cn2)Br |
InChi: | InChI=1S/C12H14BrN3/c1-10-4-2-3-5-12(10)14-6-7-16-9-11(13)8-15-16/h2-5,8-9,14H,6-7H2,1H3 |
InChiKey: | InChIKey=WQZPUCKGMGVFOP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.