* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34351938 |
| English Synonyms: | UKRORGSYN-BB BBV-34351938 |
| MDL Number.: | MFCD16802915 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(sc1)COCCNCc2ccoc2 |
| InChi: | InChI=1S/C12H15NO2S/c1-2-12(16-7-1)10-15-6-4-13-8-11-3-5-14-9-11/h1-3,5,7,9,13H,4,6,8,10H2 |
| InChiKey: | InChIKey=GNGOORLYDASKKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.