* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34351952 |
English Synonyms: | UKRORGSYN-BB BBV-34351952 |
MDL Number.: | MFCD16802929 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CN(C)CCCNCCOCc1cccs1 |
InChi: | InChI=1S/C12H22N2OS/c1-14(2)8-4-6-13-7-9-15-11-12-5-3-10-16-12/h3,5,10,13H,4,6-9,11H2,1-2H3 |
InChiKey: | InChIKey=MXFMCIZJLBRDHY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.