* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34352657 |
English Synonyms: | UKRORGSYN-BB BBV-34352657 |
MDL Number.: | MFCD16803632 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cn1c(nnn1)SCCNCC=C |
InChi: | InChI=1S/C7H13N5S/c1-3-4-8-5-6-13-7-9-10-11-12(7)2/h3,8H,1,4-6H2,2H3 |
InChiKey: | InChIKey=GIHAXIYZCIHZKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.