* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534181 |
English Synonyms: | UKRORGSYN-BB BBV-34534181 |
MDL Number.: | MFCD16808462 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CNC(c1cccs1)C2CCCCCC2 |
InChi: | InChI=1S/C13H21NS/c1-14-13(12-9-6-10-15-12)11-7-4-2-3-5-8-11/h6,9-11,13-14H,2-5,7-8H2,1H3 |
InChiKey: | InChIKey=VNVUBHMEVLLNBG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.