* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534258 |
English Synonyms: | UKRORGSYN-BB BBV-34534258 |
MDL Number.: | MFCD16808538 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cscc1CC(=O)C2CCCCCC2 |
InChi: | InChI=1S/C13H18OS/c14-13(9-11-7-8-15-10-11)12-5-3-1-2-4-6-12/h7-8,10,12H,1-6,9H2 |
InChiKey: | InChIKey=VAPZGEBBBYQXGN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.