* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534263 |
English Synonyms: | UKRORGSYN-BB BBV-34534263 |
MDL Number.: | MFCD16808543 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(sc1)CC(C2CCCCCC2)N |
InChi: | InChI=1S/C13H21NS/c14-13(10-12-8-5-9-15-12)11-6-3-1-2-4-7-11/h5,8-9,11,13H,1-4,6-7,10,14H2 |
InChiKey: | InChIKey=UKHKIHNAVOUWIU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.