* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34534820 |
English Synonyms: | UKRORGSYN-BB BBV-34534820 |
MDL Number.: | MFCD16809069 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(c1nc(on1)CCOC)N |
InChi: | InChI=1S/C7H13N3O2/c1-5(8)7-9-6(12-10-7)3-4-11-2/h5H,3-4,8H2,1-2H3 |
InChiKey: | InChIKey=MAQJERLKVJKWAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.