* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535527 |
English Synonyms: | UKRORGSYN-BB BBV-34535527 |
MDL Number.: | MFCD16809734 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1N(C)Cc2cscn2)N |
InChi: | InChI=1S/C12H15N3S/c1-9-3-4-10(13)5-12(9)15(2)6-11-7-16-8-14-11/h3-5,7-8H,6,13H2,1-2H3 |
InChiKey: | InChIKey=AXLLJVHEWUWGEX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.