* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535533 |
English Synonyms: | UKRORGSYN-BB BBV-34535533 |
MDL Number.: | MFCD16809740 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1NCc2cc(on2)C)N |
InChi: | InChI=1S/C12H15N3O/c1-8-3-4-10(13)6-12(8)14-7-11-5-9(2)16-15-11/h3-6,14H,7,13H2,1-2H3 |
InChiKey: | InChIKey=XHHRNFPYTGMDKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.