* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34535536 |
English Synonyms: | UKRORGSYN-BB BBV-34535536 |
MDL Number.: | MFCD16809743 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | Cc1ccc(cc1NCc2[nH]nnn2)N |
InChi: | InChI=1S/C9H12N6/c1-6-2-3-7(10)4-8(6)11-5-9-12-14-15-13-9/h2-4,11H,5,10H2,1H3,(H,12,13,14,15) |
InChiKey: | InChIKey=NSAODXONMSVCJB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.