* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34098620 |
English Synonyms: | UKRORGSYN-BB BBV-34098620 |
MDL Number.: | MFCD17457602 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C1CCC2CN(CCC2C1)Cc3c(snn3)NN |
InChi: | InChI=1S/C12H21N5S/c13-14-12-11(15-16-18-12)8-17-6-5-9-3-1-2-4-10(9)7-17/h9-10,14H,1-8,13H2 |
InChiKey: | InChIKey=VFHJBVGSSDXJPP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.