* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34099271 |
| English Synonyms: | UKRORGSYN-BB BBV-34099271 |
| MDL Number.: | MFCD17457683 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCN(Cc1ccco1)Cc2c(snn2)NN |
| InChi: | InChI=1S/C10H15N5OS/c1-2-15(6-8-4-3-5-16-8)7-9-10(12-11)17-14-13-9/h3-5,12H,2,6-7,11H2,1H3 |
| InChiKey: | InChIKey=WKTQSPHDAGPMMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.